C22H33NO6Si — CID 101370262
dimethyl (1S,4aR,8bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4,4a,7,8b-tetrahydro-1H-azeto[2,1-a]isoindole-5,6-dicarboxylate (PubChem CID 101370262) has the molecular formula C22H33NO6Si and a molecular weight of 435.59 g/mol. Its IUPAC name is dimethyl (1S,4aR,8bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4,4a,7,8b-tetrahydro-1H-azeto[2,1-a]isoindole-5,6-dicarboxylate.
| Compound Name | dimethyl (1S,4aR,8bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4,4a,7,8b-tetrahydro-1H-azeto[2,1-a]isoindole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 101370262 |
| Molecular Formula | C22H33NO6Si |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | dimethyl (1S,4aR,8bS)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4,4a,7,8b-tetrahydro-1H-azeto[2,1-a]isoindole-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2CN3C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]3C2=CC1 |
| InChI | InChI=1S/C22H33NO6Si/c1-12(29-30(7,8)22(2,3)4)16-18-13-9-10-14(20(25)27-5)17(21(26)28-6)15(13)11-23(18)19(16)24/h9,12,15-16,18H,10-11H2,1-8H3/t12-,15-,16-,18-/m1/s1 |
| InChIKey | TXSWXTSYJKUBGU-HALQFCHDSA-N |
| XLogP | 2.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|