C28H35NO5Si — CID 10529200
(3aS,4S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(2,5-dimethoxyphenyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 10529200) has the molecular formula C28H35NO5Si and a molecular weight of 493.68 g/mol. Its IUPAC name is (3aS,4S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(2,5-dimethoxyphenyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(2,5-dimethoxyphenyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 10529200 |
| Molecular Formula | C28H35NO5Si |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (3aS,4S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-4-(2,5-dimethoxyphenyl)-2-phenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@H]2C=C(O[Si](C)(C)C(C)(C)C)C[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]23)c1 |
| InChI | InChI=1S/C28H35NO5Si/c1-28(2,3)35(6,7)34-20-16-22(21-15-19(32-4)13-14-24(21)33-5)25-23(17-20)26(30)29(27(25)31)18-11-9-8-10-12-18/h8-16,22-23,25H,17H2,1-7H3/t22-,23-,25+/m1/s1 |
| InChIKey | IJPPEYFMVIQXBN-OYRHQHFDSA-N |
| XLogP | 5.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|