C23H21NO3 — CID 134961306
(3aS,3bR,11aR)-7-methoxy-2-phenyl-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione (PubChem CID 134961306) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is (3aS,3bR,11aR)-7-methoxy-2-phenyl-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione.
| Compound Name | (3aS,3bR,11aR)-7-methoxy-2-phenyl-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134961306 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3aS,3bR,11aR)-7-methoxy-2-phenyl-3a,3b,4,5,11,11a-hexahydronaphtho[2,1-e]isoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)CC[C@H]1C2=CC[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C23H21NO3/c1-27-16-8-10-17-14(13-16)7-9-19-18(17)11-12-20-21(19)23(26)24(22(20)25)15-5-3-2-4-6-15/h2-6,8,10-11,13,19-21H,7,9,12H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | BFDPNIJBRUOBGM-HBMCJLEFSA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|