C18H22O — CID 142141815
(8R)-3-methoxy-7,8,12,13,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 142141815) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is (8R)-3-methoxy-7,8,12,13,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (8R)-3-methoxy-7,8,12,13,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142141815 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (8R)-3-methoxy-7,8,12,13,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | COc1ccc2c(c1)CC[C@H]1C2=CCC2CCCC21 |
| InChI | InChI=1S/C18H22O/c1-19-14-7-10-16-13(11-14)6-9-17-15-4-2-3-12(15)5-8-18(16)17/h7-8,10-12,15,17H,2-6,9H2,1H3/t12?,15?,17-/m1/s1 |
| InChIKey | NXPWCEDJISQZKF-MWHAMWOXSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |