C19H16F2O3 — CID 134879809
(4aR,4bS,12aS)-2,3-difluoro-8-methoxy-4a,4b,5,6,12,12a-hexahydrochrysene-1,4-dione (PubChem CID 134879809) has the molecular formula C19H16F2O3 and a molecular weight of 330.33 g/mol. Its IUPAC name is (4aR,4bS,12aS)-2,3-difluoro-8-methoxy-4a,4b,5,6,12,12a-hexahydrochrysene-1,4-dione.
| Compound Name | (4aR,4bS,12aS)-2,3-difluoro-8-methoxy-4a,4b,5,6,12,12a-hexahydrochrysene-1,4-dione |
|---|---|
| PubChem CID | 134879809 |
| Molecular Formula | C19H16F2O3 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (4aR,4bS,12aS)-2,3-difluoro-8-methoxy-4a,4b,5,6,12,12a-hexahydrochrysene-1,4-dione |
| SMILES | COc1ccc2c(c1)CC[C@@H]1C2=CC[C@@H]2C(=O)C(F)=C(F)C(=O)[C@@H]21 |
| InChI | InChI=1S/C19H16F2O3/c1-24-10-3-5-11-9(8-10)2-4-13-12(11)6-7-14-15(13)19(23)17(21)16(20)18(14)22/h3,5-6,8,13-15H,2,4,7H2,1H3/t13-,14+,15-/m1/s1 |
| InChIKey | LTTMWOYHCBVZME-QLFBSQMISA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|