C25H38O4Si — CID 155932238
ethyl (1S,2S,10aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-1,2,3,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 155932238) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is ethyl (1S,2S,10aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-1,2,3,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | ethyl (1S,2S,10aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-1,2,3,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 155932238 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | ethyl (1S,2S,10aR)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-methoxy-1,2,3,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)CC=C2c3ccc(OC)cc3CC[C@@H]21 |
| InChI | InChI=1S/C25H38O4Si/c1-8-28-24(26)23-18(16-29-30(6,7)25(2,3)4)10-12-21-20-14-11-19(27-5)15-17(20)9-13-22(21)23/h11-12,14-15,18,22-23H,8-10,13,16H2,1-7H3/t18-,22+,23-/m1/s1 |
| InChIKey | XUAZFWBUXVQUAB-YFXJRYMSSA-N |
| XLogP | 5.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|