C20H24O3 — CID 22797978
(8'S,13'S,14'S)-3'-methoxyspiro[1,3-dioxolane-2,17'-6,7,8,12,13,14,15,16-octahydrocyclopenta[a]phenanthrene] (PubChem CID 22797978) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (8'S,13'S,14'S)-3'-methoxyspiro[1,3-dioxolane-2,17'-6,7,8,12,13,14,15,16-octahydrocyclopenta[a]phenanthrene].
| Compound Name | (8'S,13'S,14'S)-3'-methoxyspiro[1,3-dioxolane-2,17'-6,7,8,12,13,14,15,16-octahydrocyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 22797978 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (8'S,13'S,14'S)-3'-methoxyspiro[1,3-dioxolane-2,17'-6,7,8,12,13,14,15,16-octahydrocyclopenta[a]phenanthrene] |
| SMILES | COc1ccc2c(c1)CC[C@@H]1C2=CC[C@H]2[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C20H24O3/c1-21-14-3-5-15-13(12-14)2-4-17-16(15)6-7-19-18(17)8-9-20(19)22-10-11-23-20/h3,5-6,12,17-19H,2,4,7-11H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | MXDKGLZLDNKIKP-QYZOEREBSA-N |
| XLogP | 3.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |