C13H16O — CID 13275751
2-methoxy-5-methyl-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 13275751) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-methoxy-5-methyl-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 2-methoxy-5-methyl-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 13275751 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-methoxy-5-methyl-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | COc1ccc2c(c1)CCCC=C2C |
| InChI | InChI=1S/C13H16O/c1-10-5-3-4-6-11-9-12(14-2)7-8-13(10)11/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | MIGKBZWYGJKIDL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |