C16H13F3O2 — CID 18377970
2-methoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene (PubChem CID 18377970) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-methoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene.
| Compound Name | 2-methoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
|---|---|
| PubChem CID | 18377970 |
| Molecular Formula | C16H13F3O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-methoxy-7-(trifluoromethoxy)-9,10-dihydrophenanthrene |
| SMILES | COc1ccc2c(c1)CCc1cc(OC(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C16H13F3O2/c1-20-12-4-6-14-10(8-12)2-3-11-9-13(5-7-15(11)14)21-16(17,18)19/h4-9H,2-3H2,1H3 |
| InChIKey | UOVCJHWJFUWZQO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |