C28H22O4 — CID 58800525
(7-methoxy-9,10-dihydrophenanthren-2-yl) 6-acetylnaphthalene-2-carboxylate (PubChem CID 58800525) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is (7-methoxy-9,10-dihydrophenanthren-2-yl) 6-acetylnaphthalene-2-carboxylate.
| Compound Name | (7-methoxy-9,10-dihydrophenanthren-2-yl) 6-acetylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58800525 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (7-methoxy-9,10-dihydrophenanthren-2-yl) 6-acetylnaphthalene-2-carboxylate |
| SMILES | COc1ccc2c(c1)CCc1cc(OC(=O)c3ccc4cc(C(C)=O)ccc4c3)ccc1-2 |
| InChI | InChI=1S/C28H22O4/c1-17(29)18-3-4-20-14-23(8-5-19(20)13-18)28(30)32-25-10-12-27-22(16-25)7-6-21-15-24(31-2)9-11-26(21)27/h3-5,8-16H,6-7H2,1-2H3 |
| InChIKey | WBYJPBCSTMFGDM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|