C11H13NO2 — CID 11030624
5-methoxy-N-methyl-2,3-dihydroinden-1-imine oxide (PubChem CID 11030624) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-methoxy-N-methyl-2,3-dihydroinden-1-imine oxide.
| Compound Name | 5-methoxy-N-methyl-2,3-dihydroinden-1-imine oxide |
|---|---|
| PubChem CID | 11030624 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-methoxy-N-methyl-2,3-dihydroinden-1-imine oxide |
| SMILES | COc1ccc2c(c1)CC/C2=[N+](\C)[O-] |
| InChI | InChI=1S/C11H13NO2/c1-12(13)11-6-3-8-7-9(14-2)4-5-10(8)11/h4-5,7H,3,6H2,1-2H3/b12-11- |
| InChIKey | FLNVQILBBGYQNG-QXMHVHEDSA-N |
| XLogP | 1.57 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|