About (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate
(6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate (PubChem CID 14175471) has the molecular formula C13H11F3O3
and a molecular weight of 272.22 g/mol. Its IUPAC name is (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate.
Analyze (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate?
The IUPAC name of (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate (CID 14175471) is (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate.
What is the SMILES notation for (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate?
The canonical SMILES for (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate is COc1ccc2c(c1)CCC=C2OC(=O)C(F)(F)F.
What is the InChIKey of (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate?
The InChIKey is MLJCWFIIWIYBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3O3/c1-18-9-5-6-10-8(7-9)3-2-4-11(10)19-12(17)13(14,15)16/h4-7H,2-3H2,1H3.
What are the key properties of (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate?
(6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate has a molecular weight of 272.22 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxy-3,4-dihydronaphthalen-1-yl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 14175471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).