About ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate
ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate (PubChem CID 177232598) has the molecular formula C23H23NO3
and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate |
| PubChem CID | 177232598 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C3=CCCCc4cc(OC)ccc43)ccc2[nH]1 |
| InChI | InChI=1S/C23H23NO3/c1-3-27-23(25)22-14-17-12-16(8-11-21(17)24-22)19-7-5-4-6-15-13-18(26-2)9-10-20(15)19/h7-14,24H,3-6H2,1-2H3 |
| InChIKey | NHIHSKVZTXBMFL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate?
The IUPAC name of ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate (CID 177232598) is ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate is CCOC(=O)c1cc2cc(C3=CCCCc4cc(OC)ccc43)ccc2[nH]1.
What is the InChIKey of ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate?
The InChIKey is NHIHSKVZTXBMFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO3/c1-3-27-23(25)22-14-17-12-16(8-11-21(17)24-22)19-7-5-4-6-15-13-18(26-2)9-10-20(15)19/h7-14,24H,3-6H2,1-2H3.
What are the key properties of ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate?
ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate has a molecular weight of 361.44 g/mol, XLogP of 5.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2-methoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)-1H-indole-2-carboxylate is sourced from PubChem (CID 177232598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).