C18H16BrN3O3 — CID 175498117
ethyl 5-(2-amino-4-bromo-3-carbamoylphenyl)-1H-indole-2-carboxylate (PubChem CID 175498117) has the molecular formula C18H16BrN3O3 and a molecular weight of 402.25 g/mol. Its IUPAC name is ethyl 5-(2-amino-4-bromo-3-carbamoylphenyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-(2-amino-4-bromo-3-carbamoylphenyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175498117 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | ethyl 5-(2-amino-4-bromo-3-carbamoylphenyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(-c3ccc(Br)c(C(N)=O)c3N)ccc2[nH]1 |
| InChI | InChI=1S/C18H16BrN3O3/c1-2-25-18(24)14-8-10-7-9(3-6-13(10)22-14)11-4-5-12(19)15(16(11)20)17(21)23/h3-8,22H,2,20H2,1H3,(H2,21,23) |
| InChIKey | MEDBGEVXLCJWLT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|