C16H17NO3 — CID 164809743
ethyl 5-(3,6-dihydro-2H-pyran-4-yl)-1H-indole-2-carboxylate (PubChem CID 164809743) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 5-(3,6-dihydro-2H-pyran-4-yl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-(3,6-dihydro-2H-pyran-4-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 164809743 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl 5-(3,6-dihydro-2H-pyran-4-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C3=CCOCC3)ccc2[nH]1 |
| InChI | InChI=1S/C16H17NO3/c1-2-20-16(18)15-10-13-9-12(3-4-14(13)17-15)11-5-7-19-8-6-11/h3-5,9-10,17H,2,6-8H2,1H3 |
| InChIKey | CMQYHUFXFQJLLN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |