C23H22N2O4 — CID 11429228
(1S,2R,6S,9S)-7,7-dimethyl-4,9-diphenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione (PubChem CID 11429228) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is (1S,2R,6S,9S)-7,7-dimethyl-4,9-diphenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione.
| Compound Name | (1S,2R,6S,9S)-7,7-dimethyl-4,9-diphenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
|---|---|
| PubChem CID | 11429228 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (1S,2R,6S,9S)-7,7-dimethyl-4,9-diphenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
| SMILES | CC1(C)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]2[C@H]2C(=O)OC[C@H](c3ccccc3)N21 |
| InChI | InChI=1S/C23H22N2O4/c1-23(2)18-17(20(26)24(21(18)27)15-11-7-4-8-12-15)19-22(28)29-13-16(25(19)23)14-9-5-3-6-10-14/h3-12,16-19H,13H2,1-2H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | OACAHTGUSYSQLU-MKXGPGLRSA-N |
| XLogP | 2.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|