C11H9NO4S — CID 19011138
2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-oxazolidin-5-yl)acetic acid (PubChem CID 19011138) has the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-oxazolidin-5-yl)acetic acid.
| Compound Name | 2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-oxazolidin-5-yl)acetic acid |
|---|---|
| PubChem CID | 19011138 |
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 2-(4-oxo-3-phenyl-2-sulfanylidene-1,3-oxazolidin-5-yl)acetic acid |
| SMILES | O=C(O)CC1OC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C11H9NO4S/c13-9(14)6-8-10(15)12(11(17)16-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14) |
| InChIKey | RYZFETMTFASCKL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|