C29H24N2O4 — CID 135011161
1,3-bis(4-methoxyphenyl)-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 135011161) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis(4-methoxyphenyl)-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 135011161 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COc1ccc(N2C(=O)N(c3ccc(OC)cc3)C(c3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C29H24N2O4/c1-34-25-17-13-23(14-18-25)30-27(32)29(21-9-5-3-6-10-21,22-11-7-4-8-12-22)31(28(30)33)24-15-19-26(35-2)20-16-24/h3-20H,1-2H3 |
| InChIKey | QZLRWBAFIFYJLI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|