C29H23NO3 — CID 12823050
4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one (PubChem CID 12823050) has the molecular formula C29H23NO3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one.
| Compound Name | 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 12823050 |
| Molecular Formula | C29H23NO3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(c3ccccc3)C2(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO3/c1-33-25-19-17-24(18-20-25)30-28(32)26(21-11-5-2-6-12-21)29(30,23-15-9-4-10-16-23)27(31)22-13-7-3-8-14-22/h2-20,26H,1H3 |
| InChIKey | SWSAOJQJXUYSJB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |