About 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one
4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one (PubChem CID 12823050) has the molecular formula C29H23NO3
and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one |
| PubChem CID | 12823050 |
| Molecular Formula | C29H23NO3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(c3ccccc3)C2(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO3/c1-33-25-19-17-24(18-20-25)30-28(32)26(21-11-5-2-6-12-21)29(30,23-15-9-4-10-16-23)27(31)22-13-7-3-8-14-22/h2-20,26H,1H3 |
| InChIKey | SWSAOJQJXUYSJB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one?
The IUPAC name of 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one (CID 12823050) is 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one.
What is the SMILES notation for 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one?
The canonical SMILES for 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one is COc1ccc(N2C(=O)C(c3ccccc3)C2(C(=O)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one?
The InChIKey is SWSAOJQJXUYSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23NO3/c1-33-25-19-17-24(18-20-25)30-28(32)26(21-11-5-2-6-12-21)29(30,23-15-9-4-10-16-23)27(31)22-13-7-3-8-14-22/h2-20,26H,1H3.
What are the key properties of 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one?
4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one has a molecular weight of 433.51 g/mol, XLogP of 5.60, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-1-(4-methoxyphenyl)-3,4-diphenylazetidin-2-one is sourced from PubChem (CID 12823050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).