C22H18N2O3 — CID 15683237
5-hydroxy-4-(4-methoxyphenyl)-1,5-diphenylimidazol-2-one (PubChem CID 15683237) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 5-hydroxy-4-(4-methoxyphenyl)-1,5-diphenylimidazol-2-one.
| Compound Name | 5-hydroxy-4-(4-methoxyphenyl)-1,5-diphenylimidazol-2-one |
|---|---|
| PubChem CID | 15683237 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 5-hydroxy-4-(4-methoxyphenyl)-1,5-diphenylimidazol-2-one |
| SMILES | COc1ccc(C2=NC(=O)N(c3ccccc3)C2(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O3/c1-27-19-14-12-16(13-15-19)20-22(26,17-8-4-2-5-9-17)24(21(25)23-20)18-10-6-3-7-11-18/h2-15,26H,1H3 |
| InChIKey | HXTCMULBFDCTFY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |