About 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one
5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one (PubChem CID 135002668) has the molecular formula C24H21NO4
and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one.
Molecular Properties
| Compound Name | 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one |
| PubChem CID | 135002668 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one |
| SMILES | COc1ccc(N2C(=O)C(O)=C(c3ccccc3)C2(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-29-20-14-12-19(13-15-20)25-23(27)22(26)21(18-10-6-3-7-11-18)24(25,28)16-17-8-4-2-5-9-17/h2-15,26,28H,16H2,1H3 |
| InChIKey | LZZHSJXZODRYDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one?
The IUPAC name of 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one (CID 135002668) is 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one.
What is the SMILES notation for 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one?
The canonical SMILES for 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one is COc1ccc(N2C(=O)C(O)=C(c3ccccc3)C2(O)Cc2ccccc2)cc1.
What is the InChIKey of 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one?
The InChIKey is LZZHSJXZODRYDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO4/c1-29-20-14-12-19(13-15-20)25-23(27)22(26)21(18-10-6-3-7-11-18)24(25,28)16-17-8-4-2-5-9-17/h2-15,26,28H,16H2,1H3.
What are the key properties of 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one?
5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one has a molecular weight of 387.44 g/mol, XLogP of 3.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3,5-dihydroxy-1-(4-methoxyphenyl)-4-phenylpyrrol-2-one is sourced from PubChem (CID 135002668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).