C26H25N3O3 — CID 158972317
4-hydroxy-4-(3-isocyanophenyl)-1-(4-methoxyphenyl)-5,5-dimethyl-3-(4-methylphenyl)imidazolidin-2-one (PubChem CID 158972317) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-hydroxy-4-(3-isocyanophenyl)-1-(4-methoxyphenyl)-5,5-dimethyl-3-(4-methylphenyl)imidazolidin-2-one.
| Compound Name | 4-hydroxy-4-(3-isocyanophenyl)-1-(4-methoxyphenyl)-5,5-dimethyl-3-(4-methylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 158972317 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-hydroxy-4-(3-isocyanophenyl)-1-(4-methoxyphenyl)-5,5-dimethyl-3-(4-methylphenyl)imidazolidin-2-one |
| SMILES | [C-]#[N+]c1cccc(C2(O)N(c3ccc(C)cc3)C(=O)N(c3ccc(OC)cc3)C2(C)C)c1 |
| InChI | InChI=1S/C26H25N3O3/c1-18-9-11-22(12-10-18)29-24(30)28(21-13-15-23(32-5)16-14-21)25(2,3)26(29,31)19-7-6-8-20(17-19)27-4/h6-17,31H,1-3,5H3 |
| InChIKey | WSHWVAIRUVPZHW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|