C23H19NO2 — CID 72546126
5-hydroxy-1-(4-methylphenyl)-3,5-diphenylpyrrol-2-one (PubChem CID 72546126) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-hydroxy-1-(4-methylphenyl)-3,5-diphenylpyrrol-2-one.
| Compound Name | 5-hydroxy-1-(4-methylphenyl)-3,5-diphenylpyrrol-2-one |
|---|---|
| PubChem CID | 72546126 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-hydroxy-1-(4-methylphenyl)-3,5-diphenylpyrrol-2-one |
| SMILES | Cc1ccc(N2C(=O)C(c3ccccc3)=CC2(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO2/c1-17-12-14-20(15-13-17)24-22(25)21(18-8-4-2-5-9-18)16-23(24,26)19-10-6-3-7-11-19/h2-16,26H,1H3 |
| InChIKey | GVFLFQQMGRZGLV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |