C23H18O2 — CID 12559993
5-(4-methylphenyl)-3,5-diphenylfuran-2-one (PubChem CID 12559993) has the molecular formula C23H18O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3,5-diphenylfuran-2-one.
| Compound Name | 5-(4-methylphenyl)-3,5-diphenylfuran-2-one |
|---|---|
| PubChem CID | 12559993 |
| Molecular Formula | C23H18O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-(4-methylphenyl)-3,5-diphenylfuran-2-one |
| SMILES | Cc1ccc(C2(c3ccccc3)C=C(c3ccccc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H18O2/c1-17-12-14-20(15-13-17)23(19-10-6-3-7-11-19)16-21(22(24)25-23)18-8-4-2-5-9-18/h2-16H,1H3 |
| InChIKey | NJSFUYIXKGEOOP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |