C30H24O6 — CID 39353102
(3R,6S)-3,6-bis(4-methylphenoxy)-3,6-diphenyl-1,4-dioxane-2,5-dione (PubChem CID 39353102) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is (3R,6S)-3,6-bis(4-methylphenoxy)-3,6-diphenyl-1,4-dioxane-2,5-dione.
| Compound Name | (3R,6S)-3,6-bis(4-methylphenoxy)-3,6-diphenyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 39353102 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (3R,6S)-3,6-bis(4-methylphenoxy)-3,6-diphenyl-1,4-dioxane-2,5-dione |
| SMILES | Cc1ccc(O[C@@]2(c3ccccc3)OC(=O)[C@@](Oc3ccc(C)cc3)(c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C30H24O6/c1-21-13-17-25(18-14-21)33-29(23-9-5-3-6-10-23)27(31)36-30(28(32)35-29,24-11-7-4-8-12-24)34-26-19-15-22(2)16-20-26/h3-20H,1-2H3/t29-,30+ |
| InChIKey | DUTBUKUMFSZCHI-RNPORBBMSA-N |
| XLogP | 5.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |