C26H18O3 — CID 134948571
(11S,15R)-5-methyl-11,15-diphenyl-12,14-dioxatetracyclo[8.5.0.03,8.011,15]pentadeca-1(10),2,4,6,8-pentaen-13-one (PubChem CID 134948571) has the molecular formula C26H18O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (11S,15R)-5-methyl-11,15-diphenyl-12,14-dioxatetracyclo[8.5.0.03,8.011,15]pentadeca-1(10),2,4,6,8-pentaen-13-one.
| Compound Name | (11S,15R)-5-methyl-11,15-diphenyl-12,14-dioxatetracyclo[8.5.0.03,8.011,15]pentadeca-1(10),2,4,6,8-pentaen-13-one |
|---|---|
| PubChem CID | 134948571 |
| Molecular Formula | C26H18O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (11S,15R)-5-methyl-11,15-diphenyl-12,14-dioxatetracyclo[8.5.0.03,8.011,15]pentadeca-1(10),2,4,6,8-pentaen-13-one |
| SMILES | Cc1ccc2cc3c(cc2c1)[C@@]1(c2ccccc2)OC(=O)O[C@@]31c1ccccc1 |
| InChI | InChI=1S/C26H18O3/c1-17-12-13-18-15-22-23(16-19(18)14-17)26(21-10-6-3-7-11-21)25(22,28-24(27)29-26)20-8-4-2-5-9-20/h2-16H,1H3/t25-,26+/m0/s1 |
| InChIKey | NXFXXSLPDZHKEJ-IZZNHLLZSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |