C12H14O4 — CID 121012927
2,5,5-trimethyl-2-phenoxy-1,3-dioxolan-4-one (PubChem CID 121012927) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-phenoxy-1,3-dioxolan-4-one.
| Compound Name | 2,5,5-trimethyl-2-phenoxy-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 121012927 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2,5,5-trimethyl-2-phenoxy-1,3-dioxolan-4-one |
| SMILES | CC1(Oc2ccccc2)OC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C12H14O4/c1-11(2)10(13)15-12(3,16-11)14-9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | SZBFGGAJNDKPOH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |