C24H21O6P — CID 23416904
3,3-dimethyl-5-phenoxy-7,8-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-7-en-2-one (PubChem CID 23416904) has the molecular formula C24H21O6P and a molecular weight of 436.40 g/mol. Its IUPAC name is 3,3-dimethyl-5-phenoxy-7,8-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-7-en-2-one.
| Compound Name | 3,3-dimethyl-5-phenoxy-7,8-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-7-en-2-one |
|---|---|
| PubChem CID | 23416904 |
| Molecular Formula | C24H21O6P |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3,3-dimethyl-5-phenoxy-7,8-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-7-en-2-one |
| SMILES | CC1(C)OP2(Oc3ccccc3)(OC1=O)OC(c1ccccc1)=C(c1ccccc1)O2 |
| InChI | InChI=1S/C24H21O6P/c1-24(2)23(25)29-31(30-24,26-20-16-10-5-11-17-20)27-21(18-12-6-3-7-13-18)22(28-31)19-14-8-4-9-15-19/h3-17H,1-2H3 |
| InChIKey | XNSGTUBPHLAXOF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|