C12H15O5P — CID 23418141
5-methoxy-2-methyl-3-phenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene (PubChem CID 23418141) has the molecular formula C12H15O5P and a molecular weight of 270.22 g/mol. Its IUPAC name is 5-methoxy-2-methyl-3-phenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene.
| Compound Name | 5-methoxy-2-methyl-3-phenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene |
|---|---|
| PubChem CID | 23418141 |
| Molecular Formula | C12H15O5P |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-methoxy-2-methyl-3-phenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]non-2-ene |
| SMILES | COP12(OCCO1)OC(C)=C(c1ccccc1)O2 |
| InChI | InChI=1S/C12H15O5P/c1-10-12(11-6-4-3-5-7-11)17-18(13-2,16-10)14-8-9-15-18/h3-7H,8-9H2,1-2H3 |
| InChIKey | NYBKMESLRLVUPU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|