About 1,1'-biphenyl;methoxyphosphane
1,1'-biphenyl;methoxyphosphane (PubChem CID 69051753) has the molecular formula C13H15OP
and a molecular weight of 218.24 g/mol. Its IUPAC name is 1,1'-biphenyl;methoxyphosphane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;methoxyphosphane |
| PubChem CID | 69051753 |
| Molecular Formula | C13H15OP |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1,1'-biphenyl;methoxyphosphane |
| SMILES | COP.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.CH5OP/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-10H;3H2,1H3 |
| InChIKey | NNXAPRLAASAMPJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;methoxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;methoxyphosphane?
The IUPAC name of 1,1'-biphenyl;methoxyphosphane (CID 69051753) is 1,1'-biphenyl;methoxyphosphane.
What is the SMILES notation for 1,1'-biphenyl;methoxyphosphane?
The canonical SMILES for 1,1'-biphenyl;methoxyphosphane is COP.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;methoxyphosphane?
The InChIKey is NNXAPRLAASAMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.CH5OP/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3/h1-10H;3H2,1H3.
What are the key properties of 1,1'-biphenyl;methoxyphosphane?
1,1'-biphenyl;methoxyphosphane has a molecular weight of 218.24 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;methoxyphosphane is sourced from PubChem (CID 69051753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).