C20H22NO4P — CID 23418265
N,N,7,8-tetramethyl-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nona-2,7-dien-5-amine (PubChem CID 23418265) has the molecular formula C20H22NO4P and a molecular weight of 371.37 g/mol. Its IUPAC name is N,N,7,8-tetramethyl-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nona-2,7-dien-5-amine.
| Compound Name | N,N,7,8-tetramethyl-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nona-2,7-dien-5-amine |
|---|---|
| PubChem CID | 23418265 |
| Molecular Formula | C20H22NO4P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N,N,7,8-tetramethyl-2,3-diphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nona-2,7-dien-5-amine |
| SMILES | CC1=C(C)OP2(N(C)C)(O1)OC(c1ccccc1)=C(c1ccccc1)O2 |
| InChI | InChI=1S/C20H22NO4P/c1-15-16(2)23-26(22-15,21(3)4)24-19(17-11-7-5-8-12-17)20(25-26)18-13-9-6-10-14-18/h5-14H,1-4H3 |
| InChIKey | SMWBRUXCCFNVQR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|