C20H24N3O2P — CID 12668363
2',8'-dimethyl-4,5-diphenylspiro[1,3-dioxa-2lambda5-phosphacyclopent-4-ene-2,1'-2,5,8-triaza-1lambda5-phosphabicyclo[3.3.0]octane] (PubChem CID 12668363) has the molecular formula C20H24N3O2P and a molecular weight of 369.40 g/mol. Its IUPAC name is 2',8'-dimethyl-4,5-diphenylspiro[1,3-dioxa-2lambda5-phosphacyclopent-4-ene-2,1'-2,5,8-triaza-1lambda5-phosphabicyclo[3.3.0]octane].
| Compound Name | 2',8'-dimethyl-4,5-diphenylspiro[1,3-dioxa-2lambda5-phosphacyclopent-4-ene-2,1'-2,5,8-triaza-1lambda5-phosphabicyclo[3.3.0]octane] |
|---|---|
| PubChem CID | 12668363 |
| Molecular Formula | C20H24N3O2P |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2',8'-dimethyl-4,5-diphenylspiro[1,3-dioxa-2lambda5-phosphacyclopent-4-ene-2,1'-2,5,8-triaza-1lambda5-phosphabicyclo[3.3.0]octane] |
| SMILES | CN1CCN2CCN(C)P123OC(c1ccccc1)=C(c1ccccc1)O3 |
| InChI | InChI=1S/C20H24N3O2P/c1-21-13-15-23-16-14-22(2)26(21,23)24-19(17-9-5-3-6-10-17)20(25-26)18-11-7-4-8-12-18/h3-12H,13-16H2,1-2H3 |
| InChIKey | NSIBMNSSBDZDNY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|