C9H8O3S — CID 139915920
4-methyl-5-phenyl-1,3,2-dioxathiole 2-oxide (PubChem CID 139915920) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-methyl-5-phenyl-1,3,2-dioxathiole 2-oxide.
| Compound Name | 4-methyl-5-phenyl-1,3,2-dioxathiole 2-oxide |
|---|---|
| PubChem CID | 139915920 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-methyl-5-phenyl-1,3,2-dioxathiole 2-oxide |
| SMILES | CC1=C(c2ccccc2)OS(=O)O1 |
| InChI | InChI=1S/C9H8O3S/c1-7-9(12-13(10)11-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | YKRJVAOOEQHPNU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |