C11H11ClO2S — CID 12032605
4-chloro-5,5-dimethyl-3-phenyloxathiole 2-oxide (PubChem CID 12032605) has the molecular formula C11H11ClO2S and a molecular weight of 242.73 g/mol. Its IUPAC name is 4-chloro-5,5-dimethyl-3-phenyloxathiole 2-oxide.
| Compound Name | 4-chloro-5,5-dimethyl-3-phenyloxathiole 2-oxide |
|---|---|
| PubChem CID | 12032605 |
| Molecular Formula | C11H11ClO2S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 4-chloro-5,5-dimethyl-3-phenyloxathiole 2-oxide |
| SMILES | CC1(C)OS(=O)C(c2ccccc2)=C1Cl |
| InChI | InChI=1S/C11H11ClO2S/c1-11(2)10(12)9(15(13)14-11)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | YFBSECWMJGBGPL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |