C19H16OS — CID 101068620
1,3-diphenyl-5,6-dihydro-4H-cyclopenta[c]thiophene 2-oxide (PubChem CID 101068620) has the molecular formula C19H16OS and a molecular weight of 292.40 g/mol. Its IUPAC name is 1,3-diphenyl-5,6-dihydro-4H-cyclopenta[c]thiophene 2-oxide.
| Compound Name | 1,3-diphenyl-5,6-dihydro-4H-cyclopenta[c]thiophene 2-oxide |
|---|---|
| PubChem CID | 101068620 |
| Molecular Formula | C19H16OS |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1,3-diphenyl-5,6-dihydro-4H-cyclopenta[c]thiophene 2-oxide |
| SMILES | O=S1C(c2ccccc2)=C2CCCC2=C1c1ccccc1 |
| InChI | InChI=1S/C19H16OS/c20-21-18(14-8-3-1-4-9-14)16-12-7-13-17(16)19(21)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | SSFYCDMYQSALJU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |