C26H22O2S — CID 132509234
4-(4-methylphenyl)sulfonyl-9-phenyl-2,3-dihydro-1H-fluorene (PubChem CID 132509234) has the molecular formula C26H22O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-9-phenyl-2,3-dihydro-1H-fluorene.
| Compound Name | 4-(4-methylphenyl)sulfonyl-9-phenyl-2,3-dihydro-1H-fluorene |
|---|---|
| PubChem CID | 132509234 |
| Molecular Formula | C26H22O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-9-phenyl-2,3-dihydro-1H-fluorene |
| SMILES | Cc1ccc(S(=O)(=O)C2=C3C(=C(c4ccccc4)c4ccccc43)CCC2)cc1 |
| InChI | InChI=1S/C26H22O2S/c1-18-14-16-20(17-15-18)29(27,28)24-13-7-12-23-25(19-8-3-2-4-9-19)21-10-5-6-11-22(21)26(23)24/h2-6,8-11,14-17H,7,12-13H2,1H3 |
| InChIKey | RHIUDWBGXXWAKN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |