C22H20O3S — CID 11639175
7-(benzenesulfonyl)-1-methyl-3-phenyl-1,4,5,6-tetrahydroinden-2-one (PubChem CID 11639175) has the molecular formula C22H20O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-1-methyl-3-phenyl-1,4,5,6-tetrahydroinden-2-one.
| Compound Name | 7-(benzenesulfonyl)-1-methyl-3-phenyl-1,4,5,6-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 11639175 |
| Molecular Formula | C22H20O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 7-(benzenesulfonyl)-1-methyl-3-phenyl-1,4,5,6-tetrahydroinden-2-one |
| SMILES | CC1C(=O)C(c2ccccc2)=C2CCCC(S(=O)(=O)c3ccccc3)=C21 |
| InChI | InChI=1S/C22H20O3S/c1-15-20-18(21(22(15)23)16-9-4-2-5-10-16)13-8-14-19(20)26(24,25)17-11-6-3-7-12-17/h2-7,9-12,15H,8,13-14H2,1H3 |
| InChIKey | LGWSYXFXBFMNJJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |