C22H22 — CID 134946237
(4S)-1,4-dimethyl-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 134946237) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is (4S)-1,4-dimethyl-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | (4S)-1,4-dimethyl-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 134946237 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (4S)-1,4-dimethyl-2,5-diphenylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CC12C=C(c3ccccc3)[C@](C)(C=C1c1ccccc1)CC2 |
| InChI | InChI=1S/C22H22/c1-21-13-14-22(2,16-19(21)17-9-5-3-6-10-17)20(15-21)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/t21-,22?/m0/s1 |
| InChIKey | YFATVPIFMXTDCK-HMTLIYDFSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |