C13H14 — CID 140580358
(5,5-dimethylcyclopenta-1,3-dien-1-yl)benzene (PubChem CID 140580358) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is (5,5-dimethylcyclopenta-1,3-dien-1-yl)benzene.
| Compound Name | (5,5-dimethylcyclopenta-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 140580358 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (5,5-dimethylcyclopenta-1,3-dien-1-yl)benzene |
| SMILES | CC1(C)C=CC=C1c1ccccc1 |
| InChI | InChI=1S/C13H14/c1-13(2)10-6-9-12(13)11-7-4-3-5-8-11/h3-10H,1-2H3 |
| InChIKey | HCOHKYMBJPYYNT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |