About (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene
(5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene (PubChem CID 159527718) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene.
Analyze (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene?
The IUPAC name of (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene (CID 159527718) is (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene.
What is the SMILES notation for (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene?
The canonical SMILES for (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene is CC1(C)C=CC=C1Cc1ccccc1.
What is the InChIKey of (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene?
The InChIKey is WFAKQEOIFSJLHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-14(2)10-6-9-13(14)11-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3.
What are the key properties of (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene?
(5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene has a molecular weight of 184.28 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethylcyclopenta-1,3-dien-1-yl)methylbenzene is sourced from PubChem (CID 159527718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).