About benzylcyclooctatetraene
benzylcyclooctatetraene (PubChem CID 57201386) has the molecular formula C15H14
and a molecular weight of 194.28 g/mol. Its IUPAC name is benzylcyclooctatetraene.
Molecular Properties
| Compound Name | benzylcyclooctatetraene |
| PubChem CID | 57201386 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | benzylcyclooctatetraene |
| SMILES | C1=CC=CC(Cc2ccccc2)=CC=C1 |
| InChI | InChI=1S/C15H14/c1-2-5-9-14(10-6-3-1)13-15-11-7-4-8-12-15/h1-12H,13H2 |
| InChIKey | GQIHEGXAWBQAHN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzylcyclooctatetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylcyclooctatetraene?
The IUPAC name of benzylcyclooctatetraene (CID 57201386) is benzylcyclooctatetraene.
What is the SMILES notation for benzylcyclooctatetraene?
The canonical SMILES for benzylcyclooctatetraene is C1=CC=CC(Cc2ccccc2)=CC=C1.
What is the InChIKey of benzylcyclooctatetraene?
The InChIKey is GQIHEGXAWBQAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14/c1-2-5-9-14(10-6-3-1)13-15-11-7-4-8-12-15/h1-12H,13H2.
What are the key properties of benzylcyclooctatetraene?
benzylcyclooctatetraene has a molecular weight of 194.28 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylcyclooctatetraene is sourced from PubChem (CID 57201386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).