About benzylbenzene;isocyanic acid
benzylbenzene;isocyanic acid (PubChem CID 172862527) has the molecular formula C16H15N3O3
and a molecular weight of 297.31 g/mol. Its IUPAC name is benzylbenzene;isocyanic acid.
Molecular Properties
| Compound Name | benzylbenzene;isocyanic acid |
| PubChem CID | 172862527 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | benzylbenzene;isocyanic acid |
| SMILES | N=C=O.N=C=O.N=C=O.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.3CHNO/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;3*2-1-3/h1-10H,11H2;3*2H |
| InChIKey | ZNXHWPFMNPRKQA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;isocyanic acid?
The IUPAC name of benzylbenzene;isocyanic acid (CID 172862527) is benzylbenzene;isocyanic acid.
What is the SMILES notation for benzylbenzene;isocyanic acid?
The canonical SMILES for benzylbenzene;isocyanic acid is N=C=O.N=C=O.N=C=O.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;isocyanic acid?
The InChIKey is ZNXHWPFMNPRKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.3CHNO/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;3*2-1-3/h1-10H,11H2;3*2H.
What are the key properties of benzylbenzene;isocyanic acid?
benzylbenzene;isocyanic acid has a molecular weight of 297.31 g/mol, XLogP of 2.98, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;isocyanic acid is sourced from PubChem (CID 172862527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).