About lithium;benzylbenzene;diisocyanate
lithium;benzylbenzene;diisocyanate (PubChem CID 19690442) has the molecular formula C15H12LiN2O2-
and a molecular weight of 259.21 g/mol. Its IUPAC name is lithium;benzylbenzene;diisocyanate.
Molecular Properties
| Compound Name | lithium;benzylbenzene;diisocyanate |
| PubChem CID | 19690442 |
| Molecular Formula | C15H12LiN2O2- |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | lithium;benzylbenzene;diisocyanate |
| SMILES | [Li+].[N-]=C=O.[N-]=C=O.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2CNO.Li/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*2-1-3;/h1-10H,11H2;;;/q;2*-1;+1 |
| InChIKey | AVLXHAWQLJMUDD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze lithium;benzylbenzene;diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;benzylbenzene;diisocyanate?
The IUPAC name of lithium;benzylbenzene;diisocyanate (CID 19690442) is lithium;benzylbenzene;diisocyanate.
What is the SMILES notation for lithium;benzylbenzene;diisocyanate?
The canonical SMILES for lithium;benzylbenzene;diisocyanate is [Li+].[N-]=C=O.[N-]=C=O.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of lithium;benzylbenzene;diisocyanate?
The InChIKey is AVLXHAWQLJMUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2CNO.Li/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2*2-1-3;/h1-10H,11H2;;;/q;2*-1;+1.
What are the key properties of lithium;benzylbenzene;diisocyanate?
lithium;benzylbenzene;diisocyanate has a molecular weight of 259.21 g/mol, XLogP of 0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;benzylbenzene;diisocyanate is sourced from PubChem (CID 19690442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).