About benzylbenzene;thiocyanic acid
benzylbenzene;thiocyanic acid (PubChem CID 172833701) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is benzylbenzene;thiocyanic acid.
Molecular Properties
| Compound Name | benzylbenzene;thiocyanic acid |
| PubChem CID | 172833701 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | benzylbenzene;thiocyanic acid |
| SMILES | N#CS.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.CHNS/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2-1-3/h1-10H,11H2;3H |
| InChIKey | VWBWRMSVFYQLNM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;thiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;thiocyanic acid?
The IUPAC name of benzylbenzene;thiocyanic acid (CID 172833701) is benzylbenzene;thiocyanic acid.
What is the SMILES notation for benzylbenzene;thiocyanic acid?
The canonical SMILES for benzylbenzene;thiocyanic acid is N#CS.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;thiocyanic acid?
The InChIKey is VWBWRMSVFYQLNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.CHNS/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;2-1-3/h1-10H,11H2;3H.
What are the key properties of benzylbenzene;thiocyanic acid?
benzylbenzene;thiocyanic acid has a molecular weight of 227.33 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;thiocyanic acid is sourced from PubChem (CID 172833701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).