About benzylbenzene;N,N-dicyanoformamide
benzylbenzene;N,N-dicyanoformamide (PubChem CID 161496602) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is benzylbenzene;N,N-dicyanoformamide.
Molecular Properties
| Compound Name | benzylbenzene;N,N-dicyanoformamide |
| PubChem CID | 161496602 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | benzylbenzene;N,N-dicyanoformamide |
| SMILES | N#CN(C#N)C=O.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C3HN3O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;4-1-6(2-5)3-7/h1-10H,11H2;3H |
| InChIKey | WGHFJLUHJZPCCB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;N,N-dicyanoformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;N,N-dicyanoformamide?
The IUPAC name of benzylbenzene;N,N-dicyanoformamide (CID 161496602) is benzylbenzene;N,N-dicyanoformamide.
What is the SMILES notation for benzylbenzene;N,N-dicyanoformamide?
The canonical SMILES for benzylbenzene;N,N-dicyanoformamide is N#CN(C#N)C=O.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;N,N-dicyanoformamide?
The InChIKey is WGHFJLUHJZPCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C3HN3O/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;4-1-6(2-5)3-7/h1-10H,11H2;3H.
What are the key properties of benzylbenzene;N,N-dicyanoformamide?
benzylbenzene;N,N-dicyanoformamide has a molecular weight of 263.30 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;N,N-dicyanoformamide is sourced from PubChem (CID 161496602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).