C12H12IN — CID 175287153
1-iodo-2-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 175287153) has the molecular formula C12H12IN and a molecular weight of 297.14 g/mol. Its IUPAC name is 1-iodo-2-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1-iodo-2-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 175287153 |
| Molecular Formula | C12H12IN |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1-iodo-2-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1(I)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C12H12IN/c13-12(14)9-5-4-8-11(12)10-6-2-1-3-7-10/h1-8H,9,14H2 |
| InChIKey | CXHWVIUBJGPSAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|