C13H15BO3 — CID 68649281
(1-methoxy-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid (PubChem CID 68649281) has the molecular formula C13H15BO3 and a molecular weight of 230.07 g/mol. Its IUPAC name is (1-methoxy-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid.
| Compound Name | (1-methoxy-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
|---|---|
| PubChem CID | 68649281 |
| Molecular Formula | C13H15BO3 |
| Molecular Weight | 230.07 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (1-methoxy-2-phenylcyclohexa-2,4-dien-1-yl)boronic acid |
| SMILES | COC1(B(O)O)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C13H15BO3/c1-17-13(14(15)16)10-6-5-9-12(13)11-7-3-2-4-8-11/h2-9,15-16H,10H2,1H3 |
| InChIKey | MVACXBINKFJXNS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|