C14H16BFO2 — CID 151882628
[2-(4-ethylphenyl)-1-fluorocyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 151882628) has the molecular formula C14H16BFO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-1-fluorocyclohexa-2,4-dien-1-yl]boronic acid.
| Compound Name | [2-(4-ethylphenyl)-1-fluorocyclohexa-2,4-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 151882628 |
| Molecular Formula | C14H16BFO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | [2-(4-ethylphenyl)-1-fluorocyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | CCc1ccc(C2=CC=CCC2(F)B(O)O)cc1 |
| InChI | InChI=1S/C14H16BFO2/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14(13,16)15(17)18/h3-9,17-18H,2,10H2,1H3 |
| InChIKey | SPAQRSXGPKWNIA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|