C15H18BFO2 — CID 154506321
[1-fluoro-2-(4-propylphenyl)cyclohexa-2,4-dien-1-yl]boronic acid (PubChem CID 154506321) has the molecular formula C15H18BFO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is [1-fluoro-2-(4-propylphenyl)cyclohexa-2,4-dien-1-yl]boronic acid.
| Compound Name | [1-fluoro-2-(4-propylphenyl)cyclohexa-2,4-dien-1-yl]boronic acid |
|---|---|
| PubChem CID | 154506321 |
| Molecular Formula | C15H18BFO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [1-fluoro-2-(4-propylphenyl)cyclohexa-2,4-dien-1-yl]boronic acid |
| SMILES | CCCc1ccc(C2=CC=CCC2(F)B(O)O)cc1 |
| InChI | InChI=1S/C15H18BFO2/c1-2-5-12-7-9-13(10-8-12)14-6-3-4-11-15(14,17)16(18)19/h3-4,6-10,18-19H,2,5,11H2,1H3 |
| InChIKey | OYGVORFSZYEDAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|