C36H35BF4O2 — CID 160834233
[4-(4-propylphenyl)phenyl]boronic acid;5,5,6,6-tetrafluoro-1-[4-(4-propylphenyl)phenyl]cyclohexa-1,3-diene (PubChem CID 160834233) has the molecular formula C36H35BF4O2 and a molecular weight of 586.48 g/mol. Its IUPAC name is [4-(4-propylphenyl)phenyl]boronic acid;5,5,6,6-tetrafluoro-1-[4-(4-propylphenyl)phenyl]cyclohexa-1,3-diene.
| Compound Name | [4-(4-propylphenyl)phenyl]boronic acid;5,5,6,6-tetrafluoro-1-[4-(4-propylphenyl)phenyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 160834233 |
| Molecular Formula | C36H35BF4O2 |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [4-(4-propylphenyl)phenyl]boronic acid;5,5,6,6-tetrafluoro-1-[4-(4-propylphenyl)phenyl]cyclohexa-1,3-diene |
| SMILES | CCCc1ccc(-c2ccc(B(O)O)cc2)cc1.CCCc1ccc(-c2ccc(C3=CC=CC(F)(F)C3(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F4.C15H17BO2/c1-2-4-15-6-8-16(9-7-15)17-10-12-18(13-11-17)19-5-3-14-20(22,23)21(19,24)25;1-2-3-12-4-6-13(7-5-12)14-8-10-15(11-9-14)16(17)18/h3,5-14H,2,4H2,1H3;4-11,17-18H,2-3H2,1H3 |
| InChIKey | SHEWWPXWGPUJDO-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|